4,6-diphenoxy-N,N-diprop-2-enyl-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-diphenoxy-N,N-diprop-2-enyl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 4036-49-1 | Molecular Weight | 360.40900 | |
| Density | 1.183g/cm3 | Boiling Point | 519.8ºC at 760 mmHg | |
| Molecular Formula | C21H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.2ºC | |
| Name | 4,6-diphenoxy-N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 519.8ºC at 760 mmHg |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.40900 |
| Flash Point | 268.2ºC |
| Exact Mass | 360.15900 |
| PSA | 60.37000 |
| LogP | 4.63460 |
| Vapour Pressure | 6.59E-11mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | KIEQYKOEVAGOEY-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)c1nc(Oc2ccccc2)nc(Oc2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 4,6-diphenoxy-N,N-di(prop-2-en-1-yl)-1,3,5-triazin-2-amine |
| diallyl-(4,6-diphenoxy-[1,3,5]triazin-2-yl)-amine |