10-(2-ethylhexyl)phenothiazine-3,7-dicarbaldehyde structure
|
Common Name | 10-(2-ethylhexyl)phenothiazine-3,7-dicarbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 403610-12-8 | Molecular Weight | 367.50400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-(2-ethylhexyl)phenothiazine-3,7-dicarbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H25NO2S |
|---|---|
| Molecular Weight | 367.50400 |
| Exact Mass | 367.16100 |
| PSA | 62.68000 |
| LogP | 6.19570 |
| InChIKey | QRJDUVNCYIKAJM-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN1c2ccc(C=O)cc2Sc2cc(C=O)ccc21 |
|
~%
10-(2-ethylhexy... CAS#:403610-12-8 |
| Literature: Han, Yoon Soo; Kim, Sang Dae; Kwon, Younghwan; Choi, Kyu-Han; Park, Lee Soon Molecular Crystals and Liquid Crystals, 2006 , vol. 459, # 1 p. 119/[399]-128/[408] |
|
~%
10-(2-ethylhexy... CAS#:403610-12-8 |
| Literature: Han, Yoon Soo; Kim, Sang Dae; Kwon, Younghwan; Choi, Kyu-Han; Park, Lee Soon Molecular Crystals and Liquid Crystals, 2006 , vol. 459, # 1 p. 119/[399]-128/[408] |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(2-ethylhexyl)-3,6-diformylphenothiazine |
| 10H-Phenothiazine-3,7-dicarboxaldehyde,10-(2-ethylhexyl) |