2-diazonio-5-sulfonaphthalen-1-olate,phenyl-(2,3,4-trihydroxyphenyl)methanone structure
|
Common Name | 2-diazonio-5-sulfonaphthalen-1-olate,phenyl-(2,3,4-trihydroxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 40377-69-3 | Molecular Weight | 480.44700 | |
| Density | 1.51g/cm3 | Boiling Point | 748.3ºC at 760mmHg | |
| Molecular Formula | C23H16N2O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-diazonio-5-sulfonaphthalen-1-olate,phenyl-(2,3,4-trihydroxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 748.3ºC at 760mmHg |
| Molecular Formula | C23H16N2O8S |
| Molecular Weight | 480.44700 |
| Exact Mass | 480.06300 |
| PSA | 191.72000 |
| LogP | 5.04928 |
| Index of Refraction | 1.697 |
| InChIKey | WBJVMNANLDCSFR-UHFFFAOYSA-N |
| SMILES | N#[N+]c1ccc2c(S(=O)(=O)O)cccc2c1[O-].O=C(c1ccccc1)c1ccc(O)c(O)c1O |
| 6-Diazo-5,6-dihydro-5-oxonaphthalene-1-sulphonic acid,monoester with 2,3,4-trihydroxybenzophenone |
| EINECS 254-897-0 |