(2,5-dimethoxyphenyl)-phenyl-methanone structure
|
Common Name | (2,5-dimethoxyphenyl)-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 4038-13-5 | Molecular Weight | 242.27000 | |
| Density | 1.123g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | (2,5-dimethoxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 193.4ºC |
| Exact Mass | 242.09400 |
| PSA | 35.53000 |
| LogP | 2.93480 |
| Vapour Pressure | 6.25E-07mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | PKEAHRFPMAHKBR-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)c2ccccc2)c1 |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,5-dimethoxyphenyl(phenyl)ketone |
| 1-(2,5-dimethoxyphenyl)phenylmethanone |
| 2,5-Dimethoxy-benzophenon |
| dimethoxy-2,5 benzophenone |
| PhCO-C6H4-2,5-(OMe)2 |
| 2,5-dimethoxy-benzophenone |
| (2,5-dimethoxyphenyl)phenylmethanone |