2,6-diamino-5-hexyl-1H-pyrimidin-4-one structure
|
Common Name | 2,6-diamino-5-hexyl-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 4038-53-3 | Molecular Weight | 210.27600 | |
| Density | 1.27g/cm3 | Boiling Point | 349ºC at 760 mmHg | |
| Molecular Formula | C10H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.9ºC | |
| Name | 2,6-diamino-5-hexyl-1H-pyrimidin-4-one |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 349ºC at 760 mmHg |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.27600 |
| Flash Point | 164.9ºC |
| Exact Mass | 210.14800 |
| PSA | 97.79000 |
| LogP | 2.21950 |
| Vapour Pressure | 4.84E-05mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | UZSWVTQCFXCQDS-UHFFFAOYSA-N |
| SMILES | CCCCCCc1c(N)nc(N)[nH]c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |