4 (1H)-Pyrimidinone, 2-amino-6-methyl-5-octyl- structure
|
Common Name | 4 (1H)-Pyrimidinone, 2-amino-6-methyl-5-octyl- | ||
|---|---|---|---|---|
| CAS Number | 4038-57-7 | Molecular Weight | 237.34100 | |
| Density | 1.1g/cm3 | Boiling Point | 361.8ºC at 760 mmHg | |
| Molecular Formula | C13H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | 2-amino-6-methyl-5-octyl-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 361.8ºC at 760 mmHg |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.34100 |
| Flash Point | 172.6ºC |
| Exact Mass | 237.18400 |
| PSA | 71.77000 |
| LogP | 3.14470 |
| Vapour Pressure | 2.02E-05mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | KAVWOTQVDDCBHZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1=C(N=C(NC1=O)N)C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Octyl-2-amino-6-methyl-4-pyrimidinol |
| 4-Pyrimidinol,2-amino-6-methyl-5-octyl |
| 2-amino-6-methyl-5-octyl-3H-pyrimidin-4-one |