methyl 3-[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]propanoate structure
|
Common Name | methyl 3-[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]propanoate | ||
|---|---|---|---|---|
| CAS Number | 4038-90-8 | Molecular Weight | 258.31400 | |
| Density | 1.091g/cm3 | Boiling Point | 340.4ºC at 760mmHg | |
| Molecular Formula | C12H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.7ºC | |
| Name | methyl 3-[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 340.4ºC at 760mmHg |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.31400 |
| Flash Point | 159.7ºC |
| Exact Mass | 258.15800 |
| PSA | 59.08000 |
| Vapour Pressure | 8.63E-05mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | ZNYIVYFFZCEWDY-UHFFFAOYSA-N |
| SMILES | COC(=O)CCN1CCN(CCC(=O)OC)CC1 |
| HS Code | 2933599090 |
|---|
|
~96%
methyl 3-[4-(3-... CAS#:4038-90-8 |
| Literature: Kremsner, Jennifer M.; Kappe, C. Oliver Journal of Organic Chemistry, 2006 , vol. 71, # 12 p. 4651 - 4658 |
|
~0%
methyl 3-[4-(3-... CAS#:4038-90-8 |
| Literature: Kantam, M. Lakshmi; Neeraja; Kavita; Neelima; Chaudhuri, Mihir K.; Hussain, Sahid Advanced Synthesis and Catalysis, 2005 , vol. 347, # 6 p. 763 - 766 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-bis(2-methoxycarbonylmethyl)piperazine |
| EINECS 223-724-0 |
| dimethyl piperazine-1,4-dipropionate |
| dimethyl 3,3'-piperazine-1,4-diyldipropanoate |
| 1,4-Bis[2-(methoxycarbonyl)ethyl]piperazine |
| 3-[4-(2-methoxycarbonylethyl)piperazin-1-yl]propionic acid methyl ester |
| 1,4-piperazinedipropanoic acid,dimethyl ester |
| 3,3'-piperazine-1,4-diyl-bis-propionic acid dimethyl ester |
| 1,4-Piperazinedipropionic acid,dimethyl ester |