(3-phenoxyphenyl)phosphonic acid structure
|
Common Name | (3-phenoxyphenyl)phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 4042-53-9 | Molecular Weight | 250.18700 | |
| Density | 1.41g/cm3 | Boiling Point | 457.4ºC at 760 mmHg | |
| Molecular Formula | C12H11O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.5ºC | |
| Name | (3-phenoxyphenyl)phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 457.4ºC at 760 mmHg |
| Molecular Formula | C12H11O4P |
| Molecular Weight | 250.18700 |
| Flash Point | 230.5ºC |
| Exact Mass | 250.03900 |
| PSA | 76.57000 |
| LogP | 2.28190 |
| Vapour Pressure | 3.67E-09mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | LNQJDCBMFKFXPE-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)c1cccc(Oc2ccccc2)c1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3-Phenoxy-phenylphosphonsaeure |