2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine
Modify Date: 2026-09-26 19:23:21
2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine structure
|
Common Name | 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 40423-91-4 | Molecular Weight | 253.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15N3O |
|---|---|
| Molecular Weight | 253.30 |
| InChIKey | AECNLEBIJWNKJY-UHFFFAOYSA-N |
| SMILES | ON1CC(c2ccccc2)=NNC1c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine? |
| A: Molecular formula of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine is C15H15N3O. |
| Q: What is the InChIKey of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine? |
| A: InChIKey of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine is AECNLEBIJWNKJY-UHFFFAOYSA-N. |
| Q: What is the English name of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine? |
| A: The English name of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine is 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine. |
| Q: What is the SMILES notation of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine? |
| A: SMILES notation of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine is ON1CC(c2ccccc2)=NNC1c1ccccc1. |
| Q: What is the Chinese name of 40423-91-4? |
| A: Chinese name of 40423-91-4 is 40423-91-4. |
| Q: What is the CAS number of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine? |
| A: CAS number of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine is 40423-91-4. |
| Q: What is the molecular weight of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine? |
| A: Molecular weight of 2,3,4,5-Tetrahydro-4-hydroxy-3,6-diphenyl-1,2,4-triazine is 253.30. |