2,3,4,6-Tetra-O-acetyl-D-glucopyranose structure
|
Common Name | 2,3,4,6-Tetra-O-acetyl-D-glucopyranose | ||
|---|---|---|---|---|
| CAS Number | 40437-08-9 | Molecular Weight | 348.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,6-Tetra-O-acetyl-D-glucopyranose |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O10 |
|---|---|
| Molecular Weight | 348.30300 |
| Exact Mass | 348.10600 |
| PSA | 134.66000 |
| InChIKey | YOFGCSKEYMCZKK-XJFOESAGSA-N |
| SMILES | CC(=O)OCC(O)C(OC(C)=O)C(OC(C)=O)C(C=O)OC(C)=O |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| acetobromolaminaribiose |
| O2,O3,O4,O6-Tetraacetyl-D-glucose |
| hepta-acetyllaminaribiosyl bromide |
| b-D-Mannopyranosyl chloride,tetraacetate (9CI) |
| 2,3,4,6-tetra-O-acetyl glucose |
| Mannopyranosylchloride,tetraacetate,b-D-(8CI) |
| 2,3,4,6-tetra-O-acetyl-D-glucose |