Benzamide,N-(3-chloro-2-methylphenyl)- structure
|
Common Name | Benzamide,N-(3-chloro-2-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 40447-04-9 | Molecular Weight | 245.70400 | |
| Density | 1.25g/cm3 | Boiling Point | 288.2ºC at 760mmHg | |
| Molecular Formula | C14H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.1ºC | |
| Name | N-(3-chloro-2-methylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 288.2ºC at 760mmHg |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.70400 |
| Flash Point | 128.1ºC |
| Exact Mass | 245.06100 |
| PSA | 29.10000 |
| LogP | 3.97370 |
| Index of Refraction | 1.637 |
| InChIKey | YYBZYCYXYZUIHL-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,N-(3-... CAS#:40447-04-9 |
| Literature: Cohn,P. Monatshefte fuer Chemie, 1901 , vol. 22, p. 474 |
|
~%
Benzamide,N-(3-... CAS#:40447-04-9 |
| Literature: Cohn,P. Monatshefte fuer Chemie, 1901 , vol. 22, p. 474 |
|
~%
Benzamide,N-(3-... CAS#:40447-04-9 |
| Literature: Cohn,P. Monatshefte fuer Chemie, 1901 , vol. 22, p. 474 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3-chloro-o-tolyl)benzamide |
| benzoic acid-(3-chloro-2-methyl-anilide) |
| N-(3-chloro-2-methylphenyl)-benzamide |
| 6-Chlor-2-benzamino-toluol |
| Benzamide,N-(3-chloro-2-methylphenyl) |
| Benzoesaeure-(3-chlor-2-methyl-anilid) |
| EINECS 254-922-5 |