6-BROMO-2-(THIOPHEN-2-YL)H-IMIDAZO[1,2-A]PYRIDINE structure
|
Common Name | 6-BROMO-2-(THIOPHEN-2-YL)H-IMIDAZO[1,2-A]PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 4045-00-5 | Molecular Weight | 279.15600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7BrN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Bromo-2-(2-thienyl)imidazo[1,2-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H7BrN2S |
|---|---|
| Molecular Weight | 279.15600 |
| Exact Mass | 277.95100 |
| PSA | 45.54000 |
| LogP | 3.82530 |
| InChIKey | FLJGFEFJCWFDNJ-UHFFFAOYSA-N |
| SMILES | Brc1ccc2nc(-c3cccs3)cn2c1 |
|
~%
6-BROMO-2-(THIO... CAS#:4045-00-5 |
| Literature: Godovikova,S.N.; Gol'dfarb,Ya.L. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1965 , p. 1391 - 1397 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1965 , p. 1434 - 1441 |
| 6-bromo-2-thiophen-2-yl-imidazo[1,2-a]pyridine |
| 5-Brom-2-<2>thienyl-imidazo<1,2-a>pyridin |
| 5-Bromo-3-Nitro-Orthoxylene |
| 5-Bromo-3-nitro-othoxylene |
| 5-Brom-2.3-dimethyl-nitrobenzol (4-Brom-6-nitro-o-xylol) |
| 5-Bromo-2,3-dimethylnitrobenzene |