4-bromo-2-ethyl-N-(naphthalen-1-ylmethyl)benzenesulfonamide structure
|
Common Name | 4-bromo-2-ethyl-N-(naphthalen-1-ylmethyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 4045-66-3 | Molecular Weight | 404.32100 | |
| Density | 1.424g/cm3 | Boiling Point | 558.1ºC at 760mmHg | |
| Molecular Formula | C19H18BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.3ºC | |
| Name | 4-bromo-2-ethyl-N-(naphthalen-1-ylmethyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 558.1ºC at 760mmHg |
| Molecular Formula | C19H18BrNO2S |
| Molecular Weight | 404.32100 |
| Flash Point | 291.3ºC |
| Exact Mass | 403.02400 |
| PSA | 54.55000 |
| LogP | 6.11490 |
| Vapour Pressure | 1.73E-12mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | BQWPOCFMWYGEOJ-UHFFFAOYSA-N |
| SMILES | CCc1cc(Br)ccc1S(=O)(=O)NCc1cccc2ccccc12 |
|
~%
4-bromo-2-ethyl... CAS#:4045-66-3 |
| Literature: McBee,E.T. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3698 - 3705 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,4,5,5-Pentafluor-1-methylamino-3-methylimino-cyclopent-1-en |