(R)-1-N-BOC-3-METHANESULFONYLOXYPIPERIDINE structure
|
Common Name | (R)-1-N-BOC-3-METHANESULFONYLOXYPIPERIDINE | ||
|---|---|---|---|---|
| CAS Number | 404577-34-0 | Molecular Weight | 279.353 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 407.2±34.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.1±25.7 °C | |
| Name | tert-butyl (3R)-3-methylsulfonyloxypiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.2±34.0 °C at 760 mmHg |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.353 |
| Flash Point | 200.1±25.7 °C |
| Exact Mass | 279.114044 |
| PSA | 81.29000 |
| LogP | 0.64 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | WLAZHMYDLUILKR-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(OS(C)(=O)=O)C1 |
| HS Code | 2933399090 |
|---|
|
~99%
(R)-1-N-BOC-3-M... CAS#:404577-34-0 |
| Literature: N.V. ORGANON Patent: WO2007/65916 A1, 2007 ; Location in patent: Page/Page column 29 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl (3R)-3-[(methylsulfonyl)oxy]-1-piperidinecarboxylate |
| 1-Piperidinecarboxylic acid, 3-[(methylsulfonyl)oxy]-, 1,1-dimethylethyl ester, (3R)- |