N-benzyl-3-(4-chlorophenyl)propanamide
Modify Date: 2025-09-21 21:54:52
N-benzyl-3-(4-chlorophenyl)propanamide structure
|
Common Name | N-benzyl-3-(4-chlorophenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 40478-37-3 | Molecular Weight | 273.75700 | |
| Density | 1.17g/cm3 | Boiling Point | 483.4ºC at 760 mmHg | |
| Molecular Formula | C16H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | N-benzyl-3-(4-chlorophenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 483.4ºC at 760 mmHg |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.75700 |
| Flash Point | 246.2ºC |
| Exact Mass | 273.09200 |
| PSA | 32.59000 |
| LogP | 4.42930 |
| Index of Refraction | 1.582 |
| InChIKey | XQPWJBKUZCRBKK-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccc(Cl)cc1)NCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenepropanamide,4-chloro-N-(phenylmethyl) |
| Hydrocinnamamide,N-benzyl-p-chloro |
| N-Benzyl-p-chlorohydrocinnamamide |