N-(4-amino-2-methylphenyl)furan-2-carboxamide structure
|
Common Name | N-(4-amino-2-methylphenyl)furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 404832-64-0 | Molecular Weight | 216.23600 | |
| Density | 1.274g/cm3 | Boiling Point | 292.1ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.5ºC | |
| Name | N-(4-amino-2-methylphenyl)furan-2-carboxamide |
|---|
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 292.1ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Flash Point | 130.5ºC |
| Exact Mass | 216.09000 |
| PSA | 68.26000 |
| LogP | 3.07670 |
| Index of Refraction | 1.654 |
| InChIKey | KYIFBTMTQXRRCU-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)ccc1NC(=O)c1ccco1 |
| HS Code | 2932190090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |