ethyl N-[5,6-diamino-4-[bis(4-methoxyphenyl)methylamino]pyridin-2-yl]carbamate structure
|
Common Name | ethyl N-[5,6-diamino-4-[bis(4-methoxyphenyl)methylamino]pyridin-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 40497-69-6 | Molecular Weight | 437.49200 | |
| Density | 1.305g/cm3 | Boiling Point | 621.5ºC at 760 mmHg | |
| Molecular Formula | C23H27N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.7ºC | |
| Name | ethyl (5,6-diamino-4-((bis(4-methoxyphenyl)methyl)amino)pyridin-2-yl)carbamate |
|---|
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 621.5ºC at 760 mmHg |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.49200 |
| Flash Point | 329.7ºC |
| Exact Mass | 437.20600 |
| PSA | 133.75000 |
| LogP | 5.34150 |
| Index of Refraction | 1.67 |
| InChIKey | SFNZNMNPDHLHCF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cc(NC(c2ccc(OC)cc2)c2ccc(OC)cc2)c(N)c(N)n1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |