2,3,4,5-tetrabromo-8-oxa-7,9-diazabicyclo[4.3.0]nona-6,9-diene structure
|
Common Name | 2,3,4,5-tetrabromo-8-oxa-7,9-diazabicyclo[4.3.0]nona-6,9-diene | ||
|---|---|---|---|---|
| CAS Number | 4050-81-1 | Molecular Weight | 439.72500 | |
| Density | 2.698g/cm3 | Boiling Point | 390.7ºC at 760 mmHg | |
| Molecular Formula | C6H4Br4N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.1ºC | |
| Name | 4,5,6,7-tetrabromo-4,5,6,7-tetrahydro-2,1,3-benzoxadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.698g/cm3 |
|---|---|
| Boiling Point | 390.7ºC at 760 mmHg |
| Molecular Formula | C6H4Br4N2O |
| Molecular Weight | 439.72500 |
| Flash Point | 190.1ºC |
| Exact Mass | 435.70600 |
| PSA | 38.92000 |
| LogP | 3.48220 |
| Vapour Pressure | 5.84E-06mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | ZPFAXTFBAQWDFK-UHFFFAOYSA-N |
| SMILES | BrC1c2nonc2C(Br)C(Br)C1Br |
|
~%
2,3,4,5-tetrabr... CAS#:4050-81-1 |
| Literature: Hammick; Edwardes; Steiner Journal of the Chemical Society, 1931 , p. 3308 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 4,5,6,7-Tetrabrom-4,5,6,7-tetrahydro-benz[1,2,5]oxadiazol |
| 4,5,6,7-tetrabromo-4,5,6,7-tetrahydro-benz[1,2,5]oxadiazole |