[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] (2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate
Modify Date: 2025-09-18 11:51:43
![[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] (2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate Structure](https://image.chemsrc.com/caspic/429/40516-49-2.png)
[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] (2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate structure
|
Common Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] (2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate | ||
|---|---|---|---|---|
| CAS Number | 40516-49-2 | Molecular Weight | 713.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C49H76O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] (2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C49H76O3 |
|---|---|
| Molecular Weight | 713.12600 |
| Exact Mass | 712.57900 |
| PSA | 35.53000 |
| LogP | 14.57160 |
| InChIKey | RIQIJXOWVAHQES-UNAKLNRMSA-N |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) signa...
Source: 824
Target: AR protein [Homo sapiens]
External Id: MDAN535
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1100
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1101
|
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) sign...
Source: 824
Target: N/A
External Id: MDAV150
|
|
Name: qHTS assay for small molecules that induce genotoxicity in human embryonic kidney cel...
Source: 824
Target: RecName: Full=ATPase family AAA domain-containing protein 5; AltName: Full=Chromosome fragility-associated gene 1 protein
External Id: ELG271
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: thyroid hormone receptor beta isoform 2 [Rattus norvegicus]
External Id: TRN186
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: N/A
External Id: TRV455
|
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: Cytotoxic Profiling of Annotated Libraries Using Quantitative High-Throughput Screeni...
Source: NCGC
Target: N/A
External Id: CPF001
|
Total 62, Current Page 1 of 7
1
2
3
4
5
| Tocopheryl retinoate |
| Toco-retinoate |