2,5-Dichloro-4-nitropyridine 1-oxide structure
|
Common Name | 2,5-Dichloro-4-nitropyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 405230-81-1 | Molecular Weight | 208.987 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 429.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C5H2Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.4±27.3 °C | |
| Name | 2,5-dichloro-4-nitro-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.3±40.0 °C at 760 mmHg |
| Molecular Formula | C5H2Cl2N2O3 |
| Molecular Weight | 208.987 |
| Flash Point | 213.4±27.3 °C |
| Exact Mass | 207.944244 |
| PSA | 71.28000 |
| LogP | 0.45 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | XXLFCBBWDXLUOK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)[n+]([O-])cc1Cl |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
|
~52%
2,5-Dichloro-4-... CAS#:405230-81-1 |
| Literature: Liu; Luo; Mozdziesz; Lin; Dutschman; Gullen; Cheng; Sartorelli Nucleosides, Nucleotides and Nucleic Acids, 2001 , vol. 20, # 12 p. 1975 - 2000 |
|
~%
2,5-Dichloro-4-... CAS#:405230-81-1 |
| Literature: Liu; Luo; Mozdziesz; Lin; Dutschman; Gullen; Cheng; Sartorelli Nucleosides, Nucleotides and Nucleic Acids, 2001 , vol. 20, # 12 p. 1975 - 2000 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| T6NJ AO BG DNW EG |
| 2,5-Dichloro-4-nitropyridine N-oxide |
| Pyridine, 2,5-dichloro-4-nitro-, 1-oxide |
| Pyridine,2,5-dichloro-4-nitro-,1-oxide |
| 2,5-Dichloro-4-nitropyridine 1-oxide |