3-methylpentane-1,3,5-tricarboxylic acid structure
|
Common Name | 3-methylpentane-1,3,5-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 40530-20-9 | Molecular Weight | 218.20400 | |
| Density | 1.355g/cm3 | Boiling Point | 407.9ºC at 760 mmHg | |
| Molecular Formula | C9H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.6ºC | |
| Name | 3-methylpentane-1,3,5-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 407.9ºC at 760 mmHg |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20400 |
| Flash Point | 214.6ºC |
| Exact Mass | 218.07900 |
| PSA | 111.90000 |
| LogP | 0.80690 |
| Index of Refraction | 1.513 |
| InChIKey | NCUKEKGNFNRDLX-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)O)(CCC(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-methyl-n-pentane-1,3,5-tricarboxylic acid |
| 3-methyl-pentane-1,3,5-tricarboxylic acid |
| 3-Methyl-pentan-1,3,5-tricarbonsaeure |