2-(1-methyl-3,4,5,6-tetrahydro-2H-pyridin-1-yl)-1-phenyl-ethanone structure
|
Common Name | 2-(1-methyl-3,4,5,6-tetrahydro-2H-pyridin-1-yl)-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 40538-50-9 | Molecular Weight | 345.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-methylpiperidin-1-ium-1-yl)-1-phenylethanone,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20INO |
|---|---|
| Molecular Weight | 345.21900 |
| Exact Mass | 345.05900 |
| PSA | 17.07000 |
| InChIKey | UQIVWHZGSGJFAA-UHFFFAOYSA-M |
| SMILES | C[N+]1(CC(=O)c2ccccc2)CCCCC1.[I-] |
|
~%
2-(1-methyl-3,4... CAS#:40538-50-9 |
| Literature: Schmidt; van Ark Archiv der Pharmazie (Weinheim, Germany), 1900 , vol. 238, p. 330 |
|
~%
2-(1-methyl-3,4... CAS#:40538-50-9 |
| Literature: Cox, Brian G.; Maria Paolo De; Fini Adamo Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 10 p. 1647 - 1652 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Methyl-1-phenacyl-piperidinium,Jodid |
| 1-methyl-1-phenacyl-piperidinium,iodide |