1-propan-2-yloxycarbonylethyl cyclohexanecarboxylate structure
|
Common Name | 1-propan-2-yloxycarbonylethyl cyclohexanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4055-09-8 | Molecular Weight | 242.31100 | |
| Density | 1.049g/cm3 | Boiling Point | 315.1ºC at 760 mmHg | |
| Molecular Formula | C13H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.3ºC | |
| Name | (1-oxo-1-propan-2-yloxypropan-2-yl) cyclohexanecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 315.1ºC at 760 mmHg |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31100 |
| Flash Point | 148.3ºC |
| Exact Mass | 242.15200 |
| PSA | 52.60000 |
| LogP | 2.45000 |
| Vapour Pressure | 0.000446mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | UBNXEHYVKIQTRD-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)OC(=O)C1CCCCC1 |
| HS Code | 2916209090 |
|---|
|
~%
1-propan-2-ylox... CAS#:4055-09-8 |
| Literature: Bowman,N.S. et al. Journal of the American Chemical Society, 1965 , vol. 87, p. 4477 - 4481 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Isopropyl-lactat-cyclohexylcarboxylat |