trimethyl-(2-trimethylsilylsulfanylphenyl)sulfanylsilane structure
|
Common Name | trimethyl-(2-trimethylsilylsulfanylphenyl)sulfanylsilane | ||
|---|---|---|---|---|
| CAS Number | 40585-67-9 | Molecular Weight | 286.60400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22S2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-trimethylsilylsulfanylphenyl)sulfanylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H22S2Si2 |
|---|---|
| Molecular Weight | 286.60400 |
| Exact Mass | 286.07000 |
| PSA | 50.60000 |
| LogP | 5.54060 |
| InChIKey | CZIKHKYRFRTGOO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Sc1ccccc1S[Si](C)(C)C |
|
~72%
trimethyl-(2-tr... CAS#:40585-67-9 |
| Literature: Denney, Donald B.; Denney, Dorothy Z.; Liu, Lun-Tsu Phosphorus and Sulfur and the Related Elements, 1982 , vol. 13, p. 243 - 248 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,2-bis-trimethylsilanylsulfanyl-benzene |
| 1,2-bis(trimethylsilylthio)benzene |
| Silane,[1,2-phenylenebis(thio)]bis[trimethyl |