2,3,5,6-tetrafluoro-4-methoxybenzenesulfonyl chloride structure
|
Common Name | 2,3,5,6-tetrafluoro-4-methoxybenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 40586-69-4 | Molecular Weight | 278.60900 | |
| Density | 1.669g/cm3 | Boiling Point | 257.8ºC at 760 mmHg | |
| Molecular Formula | C7H3ClF4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.7ºC | |
| Name | 2,3,5,6-tetrafluoro-4-methoxybenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.669g/cm3 |
|---|---|
| Boiling Point | 257.8ºC at 760 mmHg |
| Molecular Formula | C7H3ClF4O3S |
| Molecular Weight | 278.60900 |
| Flash Point | 109.7ºC |
| Exact Mass | 277.94300 |
| PSA | 51.75000 |
| LogP | 3.25990 |
| Index of Refraction | 1.477 |
| InChIKey | BHLCFDPXMFGGOH-UHFFFAOYSA-N |
| SMILES | COc1c(F)c(F)c(S(=O)(=O)Cl)c(F)c1F |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD06660766 |