(5-BROMO-1H-INDOL-2-YL)METHANOL structure
|
Common Name | (5-BROMO-1H-INDOL-2-YL)METHANOL | ||
|---|---|---|---|---|
| CAS Number | 405939-59-5 | Molecular Weight | 307.57100 | |
| Density | 1.539g/cm3 | Boiling Point | 319.2ºC at 760 mmHg | |
| Molecular Formula | C10H12BrClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.9ºC | |
| Name | tert-butyl N-(5-bromo-6-chloropyridin-3-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 319.2ºC at 760 mmHg |
| Molecular Formula | C10H12BrClN2O2 |
| Molecular Weight | 307.57100 |
| Flash Point | 146.9ºC |
| Exact Mass | 305.97700 |
| PSA | 51.22000 |
| LogP | 3.91750 |
| Index of Refraction | 1.583 |
| InChIKey | QRNAOYQNEWLLSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(Cl)c(Br)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 5-bromo-6-chloropyridin-3-ylcarbamate |