cyclohex-3-ene-1-carbonyl cyclohex-3-ene-1-carboxylate structure
|
Common Name | cyclohex-3-ene-1-carbonyl cyclohex-3-ene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 40608-18-2 | Molecular Weight | 234.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclohex-3-ene-1-carbonyl cyclohex-3-ene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O3 |
|---|---|
| Molecular Weight | 234.29100 |
| Exact Mass | 234.12600 |
| PSA | 43.37000 |
| LogP | 2.76880 |
| InChIKey | VWOMPABUYLIFCY-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)C1CC=CCC1)C1CC=CCC1 |
|
~%
cyclohex-3-ene-... CAS#:40608-18-2 |
| Literature: Noyce; Weingarten Journal of the American Chemical Society, 1957 , vol. 79, p. 3098,3101 |
|
~%
cyclohex-3-ene-... CAS#:40608-18-2 |
| Literature: Noyce; Weingarten Journal of the American Chemical Society, 1957 , vol. 79, p. 3098,3101 |
|
~%
Detail
|
| Literature: Noyce; Weingarten Journal of the American Chemical Society, 1957 , vol. 79, p. 3098,3101 |
| Cyclohex-3-encarbonsaeure-anhydrid |
| cyclohex-3-enecarboxylic acid-anhydride |
| 3-Cyclohexene-1-carboxylic acid,anhydride |
| 3-cyclohexenecarboxylic anhydride |
| Cyclohex-3-en-1-carbonsaeureanhydrid |