Methyl 4-acetyl-1H-pyrrole-2-carboxylate structure
|
Common Name | Methyl 4-acetyl-1H-pyrrole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 40611-82-3 | Molecular Weight | 167.16200 | |
| Density | 1.218g/cm3 | Boiling Point | 340ºC at 760mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 118-120ºC | |
| MSDS | N/A | Flash Point | 159.4ºC | |
| Name | Methyl 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 340ºC at 760mmHg |
| Melting Point | 118-120ºC |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16200 |
| Flash Point | 159.4ºC |
| Exact Mass | 167.05800 |
| PSA | 59.16000 |
| LogP | 1.00390 |
| Index of Refraction | 1.531 |
| InChIKey | PHZUPQKYQRXDBE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(C)=O)c[nH]1 |
| HS Code | 2933990090 |
|---|
|
~44%
Methyl 4-acetyl... CAS#:40611-82-3 |
| Literature: Clark, Benjamin R.; O'Connor, Stephen; Fox, Deirdre; Leroy, Jacques; Murphy, Cormac D. Organic and Biomolecular Chemistry, 2011 , vol. 9, # 18 p. 6306 - 6311 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methylacetylpyrrolecarboxylate |
| methyl 4-acetylpyrrole-2-carboxylate |
| 4-acetyl-pyrrole-2-carboxylic acid methyl ester |