N-(2,6-Diethylphenyl)-3-oxo-3-phenylpropanamide structure
|
Common Name | N-(2,6-Diethylphenyl)-3-oxo-3-phenylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 40624-79-1 | Molecular Weight | 295.37600 | |
| Density | 1.118g/cm3 | Boiling Point | 494.6ºC at 760mmHg | |
| Molecular Formula | C19H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.2ºC | |
| Name | N-(2,6-Diethylphenyl)-3-oxo-3-phenylpropanamide |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 494.6ºC at 760mmHg |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.37600 |
| Flash Point | 174.2ºC |
| Exact Mass | 295.15700 |
| PSA | 49.66000 |
| LogP | 4.67240 |
| Index of Refraction | 1.59 |
| InChIKey | SHHJMFQTFLCFFM-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1NC(=O)CC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |