1,3-Dioxane,5-ethyl-2,2-dimethyl-5-nitro- structure
|
Common Name | 1,3-Dioxane,5-ethyl-2,2-dimethyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 4064-94-2 | Molecular Weight | 189.20900 | |
| Density | 1.12g/cm3 | Boiling Point | 253.5ºC at 760mmHg | |
| Molecular Formula | C8H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.2ºC | |
| Name | 5-ethyl-2,2-dimethyl-5-nitro-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 253.5ºC at 760mmHg |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.20900 |
| Flash Point | 103.2ºC |
| Exact Mass | 189.10000 |
| PSA | 64.28000 |
| LogP | 1.71800 |
| Vapour Pressure | 0.0182mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | NXQSEIQWULTBHS-UHFFFAOYSA-N |
| SMILES | CCC1([N+](=O)[O-])COC(C)(C)OC1 |
|
~%
1,3-Dioxane,5-e... CAS#:4064-94-2 |
| Literature: Linden; Gold Journal of Organic Chemistry, 1956 , vol. 21, p. 1175 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-Aethyl-2,2-dimethyl-5-nitro-[1,3]dioxan |
| 5-ethyl-2,2-dimethyl-5-nitro-[1,3]dioxane |
| 1,3-Dioxane,5-ethyl-2,2-dimethyl-5-nitro |