4-Indazol-2-ylphenol
Modify Date: 2025-11-04 23:14:36
4-Indazol-2-ylphenol structure
|
Common Name | 4-Indazol-2-ylphenol | ||
|---|---|---|---|---|
| CAS Number | 40643-17-2 | Molecular Weight | 210.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Indazol-2-ylphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10N2O |
|---|---|
| Molecular Weight | 210.23 |
| InChIKey | JHFUZEPROLIAPX-UHFFFAOYSA-N |
| SMILES | Oc1ccc(-n2cc3ccccc3n2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Relative binding affinity for human estrogen receptor alpha
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL836278
|
|
Name: Relative binding affinity for human estrogen receptor beta
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL836277
|
|
Name: Relative binding affinities for estrogen receptor beta and estrogen receptor alpha
Source: ChEMBL
Target: Estrogen receptor beta
External Id: CHEMBL829971
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-Indazol-2-ylphenol? |
| A: SMILES notation of 4-Indazol-2-ylphenol is Oc1ccc(-n2cc3ccccc3n2)cc1. |
| Q: What is the CAS number of 4-Indazol-2-ylphenol? |
| A: CAS number of 4-Indazol-2-ylphenol is 40643-17-2. |
| Q: What is the English name of 4-Indazol-2-ylphenol? |
| A: The English name of 4-Indazol-2-ylphenol is 4-Indazol-2-ylphenol. |
| Q: What is the InChIKey of 4-Indazol-2-ylphenol? |
| A: InChIKey of 4-Indazol-2-ylphenol is JHFUZEPROLIAPX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Indazol-2-ylphenol? |
| A: Molecular formula of 4-Indazol-2-ylphenol is C13H10N2O. |
| Q: What is the Chinese name of 40643-17-2? |
| A: Chinese name of 40643-17-2 is 40643-17-2. |
| Q: What is the molecular weight of 4-Indazol-2-ylphenol? |
| A: Molecular weight of 4-Indazol-2-ylphenol is 210.23. |