4-Bromo-1H-benzo[d]imidazol-2(3H)-one
![4-Bromo-1H-benzo[d]imidazol-2(3H)-one Structure](https://image.chemsrc.com/caspic/455/40644-16-4.png)
4-Bromo-1H-benzo[d]imidazol-2(3H)-one structure
|
Common Name | 4-Bromo-1H-benzo[d]imidazol-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 40644-16-4 | Molecular Weight | 213.03100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H5BrN2O |
|---|---|
| Molecular Weight | 213.03100 |
| Exact Mass | 211.95900 |
| PSA | 48.91000 |
| LogP | 2.03100 |
| InChIKey | MRCJIYLGWGVZJQ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cccc(Br)c2[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~77%
4-Bromo-1H-benz... CAS#:40644-16-4 |
| Literature: WYETH Patent: WO2009/108838 A1, 2009 ; Location in patent: Page/Page column 96 ; WO 2009/108838 A1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-bromo-1,2-dimethyl-5-quinoxalin-6-yl-1,2-dihydro-pyrazol-3-one |
| 4-bromo-1,3-dihydro-benzoimidazol-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: CAS number of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is 40644-16-4. |
| Q: What is the SMILES notation of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: SMILES notation of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is O=c1[nH]c2cccc(Br)c2[nH]1. |
| Q: What English synonyms does 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one have? |
| A: English synonyms of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one: 4-bromo-1,2-dimethyl-5-quinoxalin-6-yl-1,2-dihydro-pyrazol-3-one, 4-bromo-1,3-dihydro-benzoimidazol-2-one. |
| Q: What is the LogP of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: LogP of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is 2.03100. |
| Q: What is the molecular formula of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: Molecular formula of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is C7H5BrN2O. |
| Q: What is the molecular weight of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: Molecular weight of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is 213.03100. |
| Q: What is the English name of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: The English name of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one. |
| Q: What is the InChIKey of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: InChIKey of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is MRCJIYLGWGVZJQ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one? |
| A: Polar surface area (PSA) of 4-Bromo-1,3-dihydro-2H-benzimidazol-2-one is 48.91000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |