2,3-dibromo-N-(4-ethoxyphenyl)-3-phenyl-propanamide structure
|
Common Name | 2,3-dibromo-N-(4-ethoxyphenyl)-3-phenyl-propanamide | ||
|---|---|---|---|---|
| CAS Number | 4068-52-4 | Molecular Weight | 427.13000 | |
| Density | 1.595g/cm3 | Boiling Point | 514.9ºC at 760 mmHg | |
| Molecular Formula | C17H17Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.2ºC | |
| Name | 2,3-dibromo-N-(4-ethoxyphenyl)-3-phenylpropanamide |
|---|
| Density | 1.595g/cm3 |
|---|---|
| Boiling Point | 514.9ºC at 760 mmHg |
| Molecular Formula | C17H17Br2NO2 |
| Molecular Weight | 427.13000 |
| Flash Point | 265.2ºC |
| Exact Mass | 424.96300 |
| PSA | 38.33000 |
| LogP | 4.99650 |
| Index of Refraction | 1.639 |
| InChIKey | XRWUSUOKYGNNCY-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)C(Br)C(Br)c2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |