2-Chloro-4-Nitro-1-(3-(Trifluoromethyl)Phenoxy)Benzene structure
|
Common Name | 2-Chloro-4-Nitro-1-(3-(Trifluoromethyl)Phenoxy)Benzene | ||
|---|---|---|---|---|
| CAS Number | 40718-13-6 | Molecular Weight | 317.64800 | |
| Density | 1.461g/cm3 | Boiling Point | 328.1ºC at 760 mmHg | |
| Molecular Formula | C13H7ClF3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.2ºC | |
| Name | 2-chloro-4-nitro-1-[3-(trifluoromethyl)phenoxy]benzene |
|---|
| Density | 1.461g/cm3 |
|---|---|
| Boiling Point | 328.1ºC at 760 mmHg |
| Molecular Formula | C13H7ClF3NO3 |
| Molecular Weight | 317.64800 |
| Flash Point | 152.2ºC |
| Exact Mass | 317.00700 |
| PSA | 55.05000 |
| LogP | 5.58250 |
| Index of Refraction | 1.548 |
| InChIKey | CKJFVJCOFJYOOX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(C(F)(F)F)c2)c(Cl)c1 |
|
~%
2-Chloro-4-Nitr... CAS#:40718-13-6 |
| Literature: Ishikawa, Tomoyasu; Seto, Masaki; Banno, Hiroshi; Kawakita, Youichi; Oorui, Mami; Taniguchi, Takahiko; Ohta, Yoshikazu; Tamura, Toshiya; Nakayama, Akiko; Miki, Hiroshi; Kamiguchi, Hidenori; Tanaka, Toshimasa; Habuka, Noriyuki; Sogabe, Satoshi; Yano, Jason; Aertgeerts, Kathleen; Kamiyama, Keiji Journal of Medicinal Chemistry, 2011 , vol. 54, # 23 p. 8030 - 8050 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |