(2-hydroxy-4,5-dimethylphenyl)-phenylmethanone
(2-hydroxy-4,5-dimethylphenyl)-phenylmethanone structure
|
Common Name | (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 4072-14-4 | Molecular Weight | 226.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O2 |
|---|---|
| Molecular Weight | 226.27000 |
| Exact Mass | 226.09900 |
| PSA | 37.30000 |
| LogP | 3.24000 |
| InChIKey | QSVUUOPWABXUHE-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C(=O)c2ccccc2)cc1C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914400090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:4072-15-5
CAS#:2929-45-5
CAS#:5554-28-9
CAS#:98-88-4
CAS#:3845-63-4
CAS#:2571-39-3
CAS#:95-65-8
CAS#:7446-70-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methanone,(2-hydroxy-4,5-dimethylphenyl)phenyl |
| (4,5-dimethyl-2-hydroxyphenyl)(phenyl)methanone |
| 2-benzoyl-4,5-dimethylphenol |
| 2-Hydroxy-4.5-dimethylbenzophenon |
| 2-hydroxy-4,5-dimethyl-benzophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: The English name of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone is (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone. |
| Q: What is the SMILES notation of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: SMILES notation of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone is Cc1cc(O)c(C(=O)c2ccccc2)cc1C. |
| Q: What are the upstream materials of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: Related upstream materials(CAS) of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone: 4072-15-5;2929-45-5;5554-28-9;98-88-4;3845-63-4;2571-39-3;95-65-8;7446-70-0. |
| Q: What is the Chinese name of 4072-14-4? |
| A: Chinese name of 4072-14-4 is 4072-14-4. |
| Q: What is the InChIKey of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: InChIKey of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone is QSVUUOPWABXUHE-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: CAS number of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone is 4072-14-4. |
| Q: What English synonyms does (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone have? |
| A: English synonyms of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone: Methanone,(2-hydroxy-4,5-dimethylphenyl)phenyl, (4,5-dimethyl-2-hydroxyphenyl)(phenyl)methanone, 2-benzoyl-4,5-dimethylphenol, 2-Hydroxy-4.5-dimethylbenzophenon, 2-hydroxy-4,5-dimethyl-benzophenone. |
| Q: What is the molecular formula of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: Molecular formula of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone is C15H14O2. |
| Q: What is the molecular weight of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: Molecular weight of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone is 226.27000. |
| Q: What is the LogP of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone? |
| A: LogP of (2-hydroxy-4,5-dimethylphenyl)-phenylmethanone is 3.24000. |