(2-hydroxy-5-methyl-3-nitrophenyl)-phenylmethanone
Modify Date: 2025-09-13 10:50:41
(2-hydroxy-5-methyl-3-nitrophenyl)-phenylmethanone structure
|
Common Name | (2-hydroxy-5-methyl-3-nitrophenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 4072-26-8 | Molecular Weight | 257.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-hydroxy-5-methyl-3-nitrophenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11NO4 |
|---|---|
| Molecular Weight | 257.24100 |
| Exact Mass | 257.06900 |
| PSA | 83.12000 |
| LogP | 3.36300 |
| InChIKey | DDBVQKDHZLCTEK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)c2ccccc2)c(O)c([N+](=O)[O-])c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Methanone,(2-hydroxy-5-methyl-3-nitrophenyl)phenyl |