3,4,5-TRIPHENYL-1,2,4-TRIAZOLE structure
|
Common Name | 3,4,5-TRIPHENYL-1,2,4-TRIAZOLE | ||
|---|---|---|---|---|
| CAS Number | 4073-72-7 | Molecular Weight | 297.353 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 508.0±33.0 °C at 760 mmHg | |
| Molecular Formula | C20H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.0±25.4 °C | |
| Name | 3,4,5-triphenyl-1,2,4-triazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.0±33.0 °C at 760 mmHg |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.353 |
| Flash Point | 261.0±25.4 °C |
| Exact Mass | 297.126587 |
| PSA | 30.71000 |
| LogP | 6.21 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | LLTSIOOHJBUDCP-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nnc(-c3ccccc3)n2-c2ccccc2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4,5-triphenyl(1,2,4) triazole |
| 3,4,5-Triphenyl-4H-[1,2,4]triazole |
| 3,4,5-Triphenyl-4H-1,2,4-triazol |
| 4-Methyl-3,5-diphenyl-1,2,4-triazol |
| 3,4,5-TRIPHENYL-1,2,4-TRIAZOLE |
| 3,4,5-Triphenyl-4H-1,2,4-triazole |
| 4H-1,2,4-Triazole, 3,4,5-triphenyl- |