1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone structure
|
Common Name | 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone | ||
|---|---|---|---|---|
| CAS Number | 40754-15-2 | Molecular Weight | 304.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14BrN3 |
|---|---|
| Molecular Weight | 304.18 |
| InChIKey | XPXIAFUAFFGNFK-UHFFFAOYSA-N |
| SMILES | CC(=NNc1ccccc1)c1cc(Br)ccc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 40754-15-2? |
| A: Chinese name of 40754-15-2 is 40754-15-2. |
| Q: What is the InChIKey of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone? |
| A: InChIKey of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone is XPXIAFUAFFGNFK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone? |
| A: Molecular formula of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone is C14H14BrN3. |
| Q: What is the SMILES notation of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone? |
| A: SMILES notation of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone is CC(=NNc1ccccc1)c1cc(Br)ccc1N. |
| Q: What is the CAS number of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone? |
| A: CAS number of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone is 40754-15-2. |
| Q: What is the molecular weight of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone? |
| A: Molecular weight of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone is 304.18. |
| Q: What is the English name of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone? |
| A: The English name of 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone is 1-(2-Amino-5-bromophenyl)ethanone 2-phenylhydrazone. |