[4-[(3-fluorophenyl)methyl]morpholin-2-yl]methanamine,dihydrochloride structure
|
Common Name | [4-[(3-fluorophenyl)methyl]morpholin-2-yl]methanamine,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 407640-28-2 | Molecular Weight | 297.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19Cl2FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-[(3-fluorophenyl)methyl]morpholin-2-yl]methanamine,dihydrochloride |
|---|
| Molecular Formula | C12H19Cl2FN2O |
|---|---|
| Molecular Weight | 297.19600 |
| Exact Mass | 296.08600 |
| PSA | 38.49000 |
| LogP | 3.22740 |
| InChIKey | FFNQZCDJYFDKFU-UHFFFAOYSA-N |
| SMILES | Cl.Cl.NCC1CN(Cc2cccc(F)c2)CCO1 |
|
~%
[4-[(3-fluoroph... CAS#:407640-28-2 |
| Literature: Kato; Morie; Kon; Yoshida; Karasawa; Matsumoto Journal of Medicinal Chemistry, 1991 , vol. 34, # 2 p. 616 - 624 |
|
~%
[4-[(3-fluoroph... CAS#:407640-28-2 |
| Literature: Kato; Morie; Kon; Yoshida; Karasawa; Matsumoto Journal of Medicinal Chemistry, 1991 , vol. 34, # 2 p. 616 - 624 |
|
~%
[4-[(3-fluoroph... CAS#:407640-28-2 |
| Literature: Kato; Morie; Kon; Yoshida; Karasawa; Matsumoto Journal of Medicinal Chemistry, 1991 , vol. 34, # 2 p. 616 - 624 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |