2-chloro-3,5-dihydropurine-6-thione structure
|
Common Name | 2-chloro-3,5-dihydropurine-6-thione | ||
|---|---|---|---|---|
| CAS Number | 40769-62-8 | Molecular Weight | 186.62200 | |
| Density | 2.01g/cm3 | Boiling Point | 285.8ºC at 760 mmHg | |
| Molecular Formula | C5H3ClN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.7ºC | |
| Name | 2-chloro-3,7-dihydropurine-6-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.01g/cm3 |
|---|---|
| Boiling Point | 285.8ºC at 760 mmHg |
| Molecular Formula | C5H3ClN4S |
| Molecular Weight | 186.62200 |
| Flash Point | 126.7ºC |
| Exact Mass | 185.97700 |
| PSA | 89.45000 |
| LogP | 1.66890 |
| Index of Refraction | 1.944 |
| InChIKey | GSXGTHOISSEFHK-UHFFFAOYSA-N |
| SMILES | S=c1nc(Cl)[nH]c2nc[nH]c12 |
|
~%
2-chloro-3,5-di... CAS#:40769-62-8 |
| Literature: Burroughs Wellcome and Co. Patent: US2697709 , 1952 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Chlor-1,7-dihydro-purin-6-thion |
| 2-chloro-1,7-dihydro-purine-6-thione |