1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone
![1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone Structure](https://image.chemsrc.com/caspic/252/40786-20-7.png)
1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone structure
|
Common Name | 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 40786-20-7 | Molecular Weight | 315.20300 | |
| Density | 1.319g/cm3 | Boiling Point | 431.9ºC at 760 mmHg | |
| Molecular Formula | C14H19BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 431.9ºC at 760 mmHg |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.20300 |
| Flash Point | 215ºC |
| Exact Mass | 314.05200 |
| PSA | 46.53000 |
| LogP | 3.71110 |
| Index of Refraction | 1.549 |
| InChIKey | DRGBHKZRLWJAOU-UHFFFAOYSA-N |
| SMILES | CCCc1c(OCCCBr)ccc(C(C)=O)c1O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914700090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-[4-(3-bromopr... CAS#:40786-20-7 |
| Literature: Appleton,R.A. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 371 - 379 |
|
~%
1-[4-(3-bromopr... CAS#:40786-20-7 |
| Literature: G. D. Searle and Co. Patent: US4665203 A1, 1987 ; |
|
~%
1-[4-(3-bromopr... CAS#:40786-20-7 |
| Literature: G.D. Searle and Co. Patent: EP300404 A3, 1990 ; |
![methyl 7-[3-(4-acetyl-3-hydroxy-2-propylphenoxy)propoxy]-1,2,3,4-tetrahydro-8-propyl-2-naphthalenecarboxylate structure](https://image.chemsrc.com/caspic/251/120072-79-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethan-1-one |
| 4-(3-bromopropoxy)-3-n-propyl-2-hydroxyacetophenone |
| 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl] ethanone |
| 2-hydroxy-3-propyl-4-(3-bromopropyloxy)acetophenone |
| 3-(4-acetyl-3-hydroxy-2-propylphenoxy)-propyl bromide |
| 3-(2-n-propyl-3-hydroxy-4-acetyl phenoxy)-1-bromo propane |
| (4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl)-ethanone |
| 4'-(3-bromopropoxy)-2'-hydroxy-3'-n-propylacetophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: Molecular weight of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is 315.20300. |
| Q: What is the SMILES notation of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: SMILES notation of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is CCCc1c(OCCCBr)ccc(C(C)=O)c1O. |
| Q: What is the CAS number of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: CAS number of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is 40786-20-7. |
| Q: What are the upstream materials of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: Related upstream materials(CAS) of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone: 40786-69-4;109-64-8;598-17-4;120072-78-8. |
| Q: What is the boiling point of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: Boiling point of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is 431.9ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: InChIKey of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is DRGBHKZRLWJAOU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: Molecular formula of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is C14H19BrO3. |
| Q: What is the LogP of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: LogP of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is 3.71110. |
| Q: What is the polar surface area (PSA) of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: Polar surface area (PSA) of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is 46.53000. |
| Q: What is the English name of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone? |
| A: The English name of 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone is 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |