1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone structure
|
Common Name | 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 40786-20-7 | Molecular Weight | 315.20300 | |
| Density | 1.319g/cm3 | Boiling Point | 431.9ºC at 760 mmHg | |
| Molecular Formula | C14H19BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215ºC | |
| Name | 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 431.9ºC at 760 mmHg |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.20300 |
| Flash Point | 215ºC |
| Exact Mass | 314.05200 |
| PSA | 46.53000 |
| LogP | 3.71110 |
| Index of Refraction | 1.549 |
| InChIKey | DRGBHKZRLWJAOU-UHFFFAOYSA-N |
| SMILES | CCCc1c(OCCCBr)ccc(C(C)=O)c1O |
| HS Code | 2914700090 |
|---|
|
~%
1-[4-(3-bromopr... CAS#:40786-20-7 |
| Literature: Appleton,R.A. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 371 - 379 |
|
~%
1-[4-(3-bromopr... CAS#:40786-20-7 |
| Literature: G. D. Searle and Co. Patent: US4665203 A1, 1987 ; |
|
~%
1-[4-(3-bromopr... CAS#:40786-20-7 |
| Literature: G.D. Searle and Co. Patent: EP300404 A3, 1990 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl]ethan-1-one |
| 4-(3-bromopropoxy)-3-n-propyl-2-hydroxyacetophenone |
| 1-[4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl] ethanone |
| 2-hydroxy-3-propyl-4-(3-bromopropyloxy)acetophenone |
| 3-(4-acetyl-3-hydroxy-2-propylphenoxy)-propyl bromide |
| 3-(2-n-propyl-3-hydroxy-4-acetyl phenoxy)-1-bromo propane |
| (4-(3-bromopropoxy)-2-hydroxy-3-propylphenyl)-ethanone |
| 4'-(3-bromopropoxy)-2'-hydroxy-3'-n-propylacetophenone |