4-benzoylbenzene-1,3-dicarboxylic acid structure
|
Common Name | 4-benzoylbenzene-1,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 40786-99-0 | Molecular Weight | 270.23700 | |
| Density | 1.403g/cm3 | Boiling Point | 553.1ºC at 760 mmHg | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.3ºC | |
| Name | 4-benzoylbenzene-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.403g/cm3 |
|---|---|
| Boiling Point | 553.1ºC at 760 mmHg |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.23700 |
| Flash Point | 302.3ºC |
| Exact Mass | 270.05300 |
| PSA | 91.67000 |
| LogP | 2.31400 |
| Index of Refraction | 1.645 |
| InChIKey | IPRJQOGCIFOIBA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)c2ccccc2)c(C(=O)O)c1 |
| HS Code | 2918300090 |
|---|
|
~85%
4-benzoylbenzen... CAS#:40786-99-0 |
| Literature: Utz, Christopher G.; Shechter, Harold Journal of Organic Chemistry, 1985 , vol. 50, # 26 p. 5705 - 5709 |
|
~%
4-benzoylbenzen... CAS#:40786-99-0 |
| Literature: de Diesbach; Bulliard Helvetica Chimica Acta, 1924 , vol. 7, p. 624 |
|
~%
4-benzoylbenzen... CAS#:40786-99-0 |
| Literature: Pfeiffer; Roos Journal fuer Praktische Chemie (Leipzig), 1941 , vol. <2> 159, p. 13,29 |
|
~%
4-benzoylbenzen... CAS#:40786-99-0 |
| Literature: Zincke Chemische Berichte, 1872 , vol. 5, p. 799 |
|
~%
4-benzoylbenzen... CAS#:40786-99-0 |
| Literature: Zincke Chemische Berichte, 1872 , vol. 5, p. 799 |
|
~%
4-benzoylbenzen... CAS#:40786-99-0 |
| Literature: Pfeiffer; Roos Journal fuer Praktische Chemie (Leipzig), 1941 , vol. <2> 159, p. 13,29 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Benzoyl-isophthalsaeure |
| 2,4-dicarboxybenzophenone |
| benzophenone-2,4-dicarboxylic acid |
| 4-benzoyl-1,3-benzenedicarboxylic acid |
| Benzophenon-dicarbonsaeure-(2.4) |
| 4-benzoylisophthalic acid |