3-(3-Acetamidophenyl)propanoic acid structure
|
Common Name | 3-(3-Acetamidophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4080-83-5 | Molecular Weight | 207.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-Acetamidophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO3 |
|---|---|
| Molecular Weight | 207.22600 |
| Exact Mass | 207.09000 |
| PSA | 69.89000 |
| LogP | 2.31170 |
| InChIKey | NXVJTIYWMPQVFS-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(CCC(=O)O)c1 |
| HS Code | 2924299090 |
|---|
|
~%
3-(3-Acetamidop... CAS#:4080-83-5 |
| Literature: Biggs; Casy; Chu; Coutts Journal of Medicinal Chemistry, 1976 , vol. 19, # 4 p. 472 - 475 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(3-Acetylamino-phenyl)-propionsaeure |
| 3-(3-acetylamino-phenyl)-propionic acid |
| 3-Acetamino-hydrozimtsaeure |
| 3-acetamidohydrocynnamic acid |
| Benzenepropanoic acid,3-(acetylamino) |
| 3-(3-Acetamino-phenyl)-propionsaeure |