Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate
Modify Date: 2026-09-27 23:46:55
Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate structure
|
Common Name | Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate | ||
|---|---|---|---|---|
| CAS Number | 408335-67-1 | Molecular Weight | 212.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8N2O3S |
|---|---|
| Molecular Weight | 212.23 |
| InChIKey | PQVQUMBVWXOAFU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)c1csc(=O)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate? |
| A: InChIKey of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate is PQVQUMBVWXOAFU-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate? |
| A: The English name of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate is Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate. |
| Q: What is the SMILES notation of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate? |
| A: SMILES notation of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate is CCOC(=O)C(C#N)c1csc(=O)[nH]1. |
| Q: What is the molecular weight of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate? |
| A: Molecular weight of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate is 212.23. |
| Q: What is the CAS number of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate? |
| A: CAS number of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate is 408335-67-1. |
| Q: What is the molecular formula of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate? |
| A: Molecular formula of Ethyl I+/--cyano-2,3-dihydro-2-oxo-4-thiazoleacetate is C8H8N2O3S. |
| Q: What is the Chinese name of 408335-67-1? |
| A: Chinese name of 408335-67-1 is 408335-67-1. |