4-Hydroxy-2-methyl-5-nitrobenzoic acid structure
|
Common Name | 4-Hydroxy-2-methyl-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 408335-80-8 | Molecular Weight | 197.145 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 375.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | 213-214 °C | |
| MSDS | N/A | Flash Point | 169.0±16.3 °C | |
| Name | 4-Hydroxy-2-methyl-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.4±42.0 °C at 760 mmHg |
| Melting Point | 213-214 °C |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.145 |
| Flash Point | 169.0±16.3 °C |
| Exact Mass | 197.032425 |
| PSA | 103.35000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | LIDKLIGKTGJHFK-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c([N+](=O)[O-])cc1C(=O)O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Hydroxy-2-methyl-5-nitrobenzoic acid |
| Benzoic acid, 4-hydroxy-2-methyl-5-nitro- |