9-methyl-8-methylsulfanyl-3H-purine-2,6-dione structure
|
Common Name | 9-methyl-8-methylsulfanyl-3H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 40848-30-4 | Molecular Weight | 212.22900 | |
| Density | 1.76g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-methyl-8-methylsulfanyl-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Molecular Formula | C7H8N4O2S |
| Molecular Weight | 212.22900 |
| Exact Mass | 212.03700 |
| PSA | 108.84000 |
| Index of Refraction | 1.809 |
| InChIKey | LFMVZURNICHXPZ-UHFFFAOYSA-N |
| SMILES | CSc1nc2c(=O)[nH]c(=O)[nH]c2n1C |
|
~%
9-methyl-8-meth... CAS#:40848-30-4 |
| Literature: Cook; Smith Journal of the Chemical Society, 1949 , p. 2329,2331 |
|
~%
9-methyl-8-meth... CAS#:40848-30-4 |
| Literature: Cook; Smith Journal of the Chemical Society, 1949 , p. 2329,2331 |
|
~%
9-methyl-8-meth... CAS#:40848-30-4 |
| Literature: Biltz; Buelow Justus Liebigs Annalen der Chemie, 1922 , vol. 426, p. 306 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9-Methyl-8-methylmercapto-3,9-dihydro-purin-2,6-dion |
| 9-methyl-8-methylsulfanyl-3,9-dihydro-purine-2,6-dione |
| 9-Methyl-8-methylthioxanthin |