6-acetyl-7H-benzo[a]phenazin-5-one structure
|
Common Name | 6-acetyl-7H-benzo[a]phenazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 40852-82-2 | Molecular Weight | 288.30000 | |
| Density | 1.36g/cm3 | Boiling Point | 450.1ºC at 760 mmHg | |
| Molecular Formula | C18H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226ºC | |
| Name | 6-acetyl-7H-benzo[a]phenazin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 450.1ºC at 760 mmHg |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.30000 |
| Flash Point | 226ºC |
| Exact Mass | 288.09000 |
| PSA | 63.08000 |
| LogP | 3.84440 |
| Index of Refraction | 1.713 |
| InChIKey | NYVCCSCIJMMWIH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(O)c2ccccc2c2nc3ccccc3nc12 |
|
~%
6-acetyl-7H-ben... CAS#:40852-82-2 |
| Literature: Cram Journal of the American Chemical Society, 1949 , vol. 71, p. 3953,3957 |
|
~%
6-acetyl-7H-ben... CAS#:40852-82-2 |
| Literature: Cram Journal of the American Chemical Society, 1949 , vol. 71, p. 3953,3957 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-Acetyl-benzo<a>phenazin-5-ol |