(5-bromo-2-nitro-phenyl)phosphonic acid structure
|
Common Name | (5-bromo-2-nitro-phenyl)phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 4087-07-4 | Molecular Weight | 281.98500 | |
| Density | 2.07g/cm3 | Boiling Point | 498.7ºC at 760 mmHg | |
| Molecular Formula | C6H5BrNO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4ºC | |
| Name | (5-bromo-2-nitrophenyl)phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.07g/cm3 |
|---|---|
| Boiling Point | 498.7ºC at 760 mmHg |
| Molecular Formula | C6H5BrNO5P |
| Molecular Weight | 281.98500 |
| Flash Point | 255.4ºC |
| Exact Mass | 280.90900 |
| PSA | 113.16000 |
| LogP | 1.68350 |
| Index of Refraction | 1.66 |
| InChIKey | PIUNHZVSUAVOCB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1P(=O)(O)O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 5-Brom-2-nitro-phenylphosphonsaeure |