[2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol structure
|
Common Name | [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 40870-63-1 | Molecular Weight | 226.26900 | |
| Density | 1.144g/cm3 | Boiling Point | 380.1ºC at 760mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 380.1ºC at 760mmHg |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Flash Point | 183.7ºC |
| Exact Mass | 226.12100 |
| PSA | 58.92000 |
| LogP | 1.30520 |
| Index of Refraction | 1.541 |
| InChIKey | KUXBLLYYJUSAFD-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(C)c(OC)c(CO)c1CO |
| HS Code | 2909499000 |
|---|
|
~%
[2-(hydroxymeth... CAS#:40870-63-1 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
|
~%
[2-(hydroxymeth... CAS#:40870-63-1 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
|
~%
[2-(hydroxymeth... CAS#:40870-63-1 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3,6-Dimethoxy-4,5-dimethyl-1,2-benzenedimethanol |
| 3,6-Dimethoxy-4,5-dimethyl-1,2-bis(hydroxymethyl)benzene |
| 1,2-Benzenedimethanol,3,6-dimethoxy-4,5-dimethyl |