[2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol
![[2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol Structure](https://image.chemsrc.com/caspic/041/40870-63-1.png)
[2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol structure
|
Common Name | [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 40870-63-1 | Molecular Weight | 226.26900 | |
| Density | 1.144g/cm3 | Boiling Point | 380.1ºC at 760mmHg | |
| Molecular Formula | C12H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 380.1ºC at 760mmHg |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.26900 |
| Flash Point | 183.7ºC |
| Exact Mass | 226.12100 |
| PSA | 58.92000 |
| LogP | 1.30520 |
| Index of Refraction | 1.541 |
| InChIKey | KUXBLLYYJUSAFD-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(C)c(OC)c(CO)c1CO |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2909499000 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2-(hydroxymeth... CAS#:40870-63-1 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
|
~%
[2-(hydroxymeth... CAS#:40870-63-1 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
|
~%
[2-(hydroxymeth... CAS#:40870-63-1 |
| Literature: Lin; Cosby; Shansky; Sartorelli Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1247 - 1252 |
![[2-(acetyloxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methyl acetate structure](https://image.chemsrc.com/caspic/127/40870-61-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,6-Dimethoxy-4,5-dimethyl-1,2-benzenedimethanol |
| 3,6-Dimethoxy-4,5-dimethyl-1,2-bis(hydroxymethyl)benzene |
| 1,2-Benzenedimethanol,3,6-dimethoxy-4,5-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: Molecular weight of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is 226.26900. |
| Q: What is the SMILES notation of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: SMILES notation of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is COc1c(C)c(C)c(OC)c(CO)c1CO. |
| Q: What is the LogP of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: LogP of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is 1.30520. |
| Q: What is the polar surface area (PSA) of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: Polar surface area (PSA) of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is 58.92000. |
| Q: What is the InChIKey of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: InChIKey of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is KUXBLLYYJUSAFD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 40870-63-1? |
| A: Chinese name of 40870-63-1 is 40870-63-1. |
| Q: What are the upstream materials of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: Related upstream materials(CAS) of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol: 40870-60-8;39021-83-5;40870-61-9. |
| Q: What is the English name of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: The English name of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol. |
| Q: What is the molecular formula of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: Molecular formula of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is C12H18O4. |
| Q: What is the boiling point of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol? |
| A: Boiling point of [2-(hydroxymethyl)-3,6-dimethoxy-4,5-dimethylphenyl]methanol is 380.1ºC at 760mmHg. |