5-fluorosulfonylhexafluoro-3-oxapentanoyl fluoride
Modify Date: 2025-09-21 20:35:56
5-fluorosulfonylhexafluoro-3-oxapentanoyl fluoride structure
|
Common Name | 5-fluorosulfonylhexafluoro-3-oxapentanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 4089-59-2 | Molecular Weight | 296.09300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F8O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-fluorosulfonylhexafluoro-3-oxapentanoyl fluoride |
|---|
| Molecular Formula | C4F8O4S |
|---|---|
| Molecular Weight | 296.09300 |
| Exact Mass | 295.93900 |
| PSA | 68.82000 |
| LogP | 2.65760 |
| InChIKey | MOFHNOCGRKOYIE-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |